C14H21ClFN3O2 — CID 79665675
N'-(4-chloro-5-fluoro-2-nitrophenyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine (PubChem CID 79665675) has the molecular formula C14H21ClFN3O2 and a molecular weight of 317.79 g/mol. Its IUPAC name is N'-(4-chloro-5-fluoro-2-nitrophenyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine.
| Compound Name | N'-(4-chloro-5-fluoro-2-nitrophenyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79665675 |
| Molecular Formula | C14H21ClFN3O2 |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N'-(4-chloro-5-fluoro-2-nitrophenyl)-2,2-dimethyl-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(CC(C)(C)CN)c1cc(F)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21ClFN3O2/c1-4-5-18(9-14(2,3)8-17)12-7-11(16)10(15)6-13(12)19(20)21/h6-7H,4-5,8-9,17H2,1-3H3 |
| InChIKey | FRBXXSIFEDMRBH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|