C13H23N5O2 — CID 79816318
6-N-(3-amino-2,2-dimethylpropyl)-3-nitro-6-N-propylpyridine-2,6-diamine (PubChem CID 79816318) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 6-N-(3-amino-2,2-dimethylpropyl)-3-nitro-6-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-(3-amino-2,2-dimethylpropyl)-3-nitro-6-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 79816318 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 6-N-(3-amino-2,2-dimethylpropyl)-3-nitro-6-N-propylpyridine-2,6-diamine |
| SMILES | CCCN(CC(C)(C)CN)c1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C13H23N5O2/c1-4-7-17(9-13(2,3)8-14)11-6-5-10(18(19)20)12(15)16-11/h5-6H,4,7-9,14H2,1-3H3,(H2,15,16) |
| InChIKey | WYZRBOZZKHNQAS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|