About 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine
2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine (PubChem CID 79662197) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine |
| PubChem CID | 79662197 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine |
| SMILES | CCCN(CC(C)(C)CN)c1cnccn1 |
| InChI | InChI=1S/C12H22N4/c1-4-7-16(10-12(2,3)9-13)11-8-14-5-6-15-11/h5-6,8H,4,7,9-10,13H2,1-3H3 |
| InChIKey | LLQYGXPTURKFFV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine?
The IUPAC name of 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine (CID 79662197) is 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine.
What is the SMILES notation for 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine?
The canonical SMILES for 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine is CCCN(CC(C)(C)CN)c1cnccn1.
What is the InChIKey of 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine?
The InChIKey is LLQYGXPTURKFFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4/c1-4-7-16(10-12(2,3)9-13)11-8-14-5-6-15-11/h5-6,8H,4,7,9-10,13H2,1-3H3.
What are the key properties of 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine?
2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine has a molecular weight of 222.34 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N'-propyl-N'-pyrazin-2-ylpropane-1,3-diamine is sourced from PubChem (CID 79662197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).