C15H24FN3O — CID 79667605
1-(3-amino-2,2-dimethylpropyl)-3-(2-fluorophenyl)-1-propylurea (PubChem CID 79667605) has the molecular formula C15H24FN3O and a molecular weight of 281.37 g/mol. Its IUPAC name is 1-(3-amino-2,2-dimethylpropyl)-3-(2-fluorophenyl)-1-propylurea.
| Compound Name | 1-(3-amino-2,2-dimethylpropyl)-3-(2-fluorophenyl)-1-propylurea |
|---|---|
| PubChem CID | 79667605 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-(3-amino-2,2-dimethylpropyl)-3-(2-fluorophenyl)-1-propylurea |
| SMILES | CCCN(CC(C)(C)CN)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C15H24FN3O/c1-4-9-19(11-15(2,3)10-17)14(20)18-13-8-6-5-7-12(13)16/h5-8H,4,9-11,17H2,1-3H3,(H,18,20) |
| InChIKey | SFZVVUAVEXTPHR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |