C15H21BrFNO2 — CID 79668703
2-(2-bromo-4-fluorophenyl)-1-(4-propylmorpholin-2-yl)ethanol (PubChem CID 79668703) has the molecular formula C15H21BrFNO2 and a molecular weight of 346.24 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(4-propylmorpholin-2-yl)ethanol.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(4-propylmorpholin-2-yl)ethanol |
|---|---|
| PubChem CID | 79668703 |
| Molecular Formula | C15H21BrFNO2 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(4-propylmorpholin-2-yl)ethanol |
| SMILES | CCCN1CCOC(C(O)Cc2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C15H21BrFNO2/c1-2-5-18-6-7-20-15(10-18)14(19)8-11-3-4-12(17)9-13(11)16/h3-4,9,14-15,19H,2,5-8,10H2,1H3 |
| InChIKey | OXMSMVWWASAZJO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |