C13H17BrFNO2 — CID 79086890
2-(2-bromo-4-fluorophenyl)-1-(4-methylmorpholin-2-yl)ethanol (PubChem CID 79086890) has the molecular formula C13H17BrFNO2 and a molecular weight of 318.19 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(4-methylmorpholin-2-yl)ethanol.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(4-methylmorpholin-2-yl)ethanol |
|---|---|
| PubChem CID | 79086890 |
| Molecular Formula | C13H17BrFNO2 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(4-methylmorpholin-2-yl)ethanol |
| SMILES | CN1CCOC(C(O)Cc2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C13H17BrFNO2/c1-16-4-5-18-13(8-16)12(17)6-9-2-3-10(15)7-11(9)14/h2-3,7,12-13,17H,4-6,8H2,1H3 |
| InChIKey | KBIHSALJHKAMAR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |