C22H34N2O2 — CID 7967034
2-[(2,5-dimethylphenyl)methylidene]-N,N'-bis(3-methylbutyl)propanediamide (PubChem CID 7967034) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methylidene]-N,N'-bis(3-methylbutyl)propanediamide.
| Compound Name | 2-[(2,5-dimethylphenyl)methylidene]-N,N'-bis(3-methylbutyl)propanediamide |
|---|---|
| PubChem CID | 7967034 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methylidene]-N,N'-bis(3-methylbutyl)propanediamide |
| SMILES | Cc1ccc(C)c(C=C(C(=O)NCCC(C)C)C(=O)NCCC(C)C)c1 |
| InChI | InChI=1S/C22H34N2O2/c1-15(2)9-11-23-21(25)20(22(26)24-12-10-16(3)4)14-19-13-17(5)7-8-18(19)6/h7-8,13-16H,9-12H2,1-6H3,(H,23,25)(H,24,26) |
| InChIKey | KMPZMFXAIYPXBW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|