C24H32N4O2 — CID 55838959
N,N'-bis(3-methylbutyl)-2-[(2-phenylpyrimidin-5-yl)methylidene]propanediamide (PubChem CID 55838959) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N,N'-bis(3-methylbutyl)-2-[(2-phenylpyrimidin-5-yl)methylidene]propanediamide.
| Compound Name | N,N'-bis(3-methylbutyl)-2-[(2-phenylpyrimidin-5-yl)methylidene]propanediamide |
|---|---|
| PubChem CID | 55838959 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | N,N'-bis(3-methylbutyl)-2-[(2-phenylpyrimidin-5-yl)methylidene]propanediamide |
| SMILES | CC(C)CCNC(=O)C(=Cc1cnc(-c2ccccc2)nc1)C(=O)NCCC(C)C |
| InChI | InChI=1S/C24H32N4O2/c1-17(2)10-12-25-23(29)21(24(30)26-13-11-18(3)4)14-19-15-27-22(28-16-19)20-8-6-5-7-9-20/h5-9,14-18H,10-13H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | RCUJBMOQORGWGM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|