C12H15ClN4O3S — CID 79671468
4-[[5-chloro-6-(ethylamino)-3-pyridinyl]sulfonyl]morpholine-2-carbonitrile (PubChem CID 79671468) has the molecular formula C12H15ClN4O3S and a molecular weight of 330.80 g/mol. Its IUPAC name is 4-[[5-chloro-6-(ethylamino)-3-pyridinyl]sulfonyl]morpholine-2-carbonitrile.
| Compound Name | 4-[[5-chloro-6-(ethylamino)-3-pyridinyl]sulfonyl]morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 79671468 |
| Molecular Formula | C12H15ClN4O3S |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-[[5-chloro-6-(ethylamino)-3-pyridinyl]sulfonyl]morpholine-2-carbonitrile |
| SMILES | CCNc1ncc(S(=O)(=O)N2CCOC(C#N)C2)cc1Cl |
| InChI | InChI=1S/C12H15ClN4O3S/c1-2-15-12-11(13)5-10(7-16-12)21(18,19)17-3-4-20-9(6-14)8-17/h5,7,9H,2-4,8H2,1H3,(H,15,16) |
| InChIKey | UOBHYGALDOZMKA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |