C12H19ClN2O — CID 79679766
1-[[3-(chloromethyl)-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine (PubChem CID 79679766) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-[[3-(chloromethyl)-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine.
| Compound Name | 1-[[3-(chloromethyl)-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine |
|---|---|
| PubChem CID | 79679766 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[[3-(chloromethyl)-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine |
| SMILES | CN(C)C(C)(C)COc1ncccc1CCl |
| InChI | InChI=1S/C12H19ClN2O/c1-12(2,15(3)4)9-16-11-10(8-13)6-5-7-14-11/h5-7H,8-9H2,1-4H3 |
| InChIKey | SPOADLFLJKKPGJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|