C11H12INO3S — CID 79685652
1-(5-iodothiophene-3-carbonyl)-2-methylpyrrolidine-2-carboxylic acid (PubChem CID 79685652) has the molecular formula C11H12INO3S and a molecular weight of 365.19 g/mol. Its IUPAC name is 1-(5-iodothiophene-3-carbonyl)-2-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(5-iodothiophene-3-carbonyl)-2-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79685652 |
| Molecular Formula | C11H12INO3S |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 1-(5-iodothiophene-3-carbonyl)-2-methylpyrrolidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN1C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C11H12INO3S/c1-11(10(15)16)3-2-4-13(11)9(14)7-5-8(12)17-6-7/h5-6H,2-4H2,1H3,(H,15,16) |
| InChIKey | QHMOFZSSIIFKMP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|