C11H9IO2S — CID 79685758
(2,5-dimethylfuran-3-yl)-(5-iodothiophen-3-yl)methanone (PubChem CID 79685758) has the molecular formula C11H9IO2S and a molecular weight of 332.16 g/mol. Its IUPAC name is (2,5-dimethylfuran-3-yl)-(5-iodothiophen-3-yl)methanone.
| Compound Name | (2,5-dimethylfuran-3-yl)-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 79685758 |
| Molecular Formula | C11H9IO2S |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | (2,5-dimethylfuran-3-yl)-(5-iodothiophen-3-yl)methanone |
| SMILES | Cc1cc(C(=O)c2csc(I)c2)c(C)o1 |
| InChI | InChI=1S/C11H9IO2S/c1-6-3-9(7(2)14-6)11(13)8-4-10(12)15-5-8/h3-5H,1-2H3 |
| InChIKey | GSWJTOVNHHVZMI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|