C14H9Cl3N2OS — CID 79691342
5-(3-aminoprop-1-ynyl)-N-(2,4,6-trichlorophenyl)thiophene-3-carboxamide (PubChem CID 79691342) has the molecular formula C14H9Cl3N2OS and a molecular weight of 359.67 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N-(2,4,6-trichlorophenyl)thiophene-3-carboxamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N-(2,4,6-trichlorophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79691342 |
| Molecular Formula | C14H9Cl3N2OS |
| Molecular Weight | 359.67 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N-(2,4,6-trichlorophenyl)thiophene-3-carboxamide |
| SMILES | NCC#Cc1cc(C(=O)Nc2c(Cl)cc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C14H9Cl3N2OS/c15-9-5-11(16)13(12(17)6-9)19-14(20)8-4-10(21-7-8)2-1-3-18/h4-7H,3,18H2,(H,19,20) |
| InChIKey | QDZQOPDHNPQBCR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|