C9H12INO2S — CID 79692866
N-(1-hydroxy-2-methylpropan-2-yl)-5-iodothiophene-3-carboxamide (PubChem CID 79692866) has the molecular formula C9H12INO2S and a molecular weight of 325.17 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692866 |
| Molecular Formula | C9H12INO2S |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-5-iodothiophene-3-carboxamide |
| SMILES | CC(C)(CO)NC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C9H12INO2S/c1-9(2,5-12)11-8(13)6-3-7(10)14-4-6/h3-4,12H,5H2,1-2H3,(H,11,13) |
| InChIKey | ZSVOBOUNSXZAOP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|