C14H25NO4 — CID 79694845
1-(3,3-dimethoxyazetidin-1-yl)-4-ethylcyclohexane-1-carboxylic acid (PubChem CID 79694845) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-(3,3-dimethoxyazetidin-1-yl)-4-ethylcyclohexane-1-carboxylic acid.
| Compound Name | 1-(3,3-dimethoxyazetidin-1-yl)-4-ethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79694845 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 1-(3,3-dimethoxyazetidin-1-yl)-4-ethylcyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(C(=O)O)(N2CC(OC)(OC)C2)CC1 |
| InChI | InChI=1S/C14H25NO4/c1-4-11-5-7-13(8-6-11,12(16)17)15-9-14(10-15,18-2)19-3/h11H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | QYAAIMCAWMIYLI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|