C15H15Cl2NO — CID 79698284
1-(4-chloro-3-methoxyphenyl)-2-(2-chlorophenyl)ethanamine (PubChem CID 79698284) has the molecular formula C15H15Cl2NO and a molecular weight of 296.20 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-2-(2-chlorophenyl)ethanamine.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-2-(2-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 79698284 |
| Molecular Formula | C15H15Cl2NO |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-2-(2-chlorophenyl)ethanamine |
| SMILES | COc1cc(C(N)Cc2ccccc2Cl)ccc1Cl |
| InChI | InChI=1S/C15H15Cl2NO/c1-19-15-9-11(6-7-13(15)17)14(18)8-10-4-2-3-5-12(10)16/h2-7,9,14H,8,18H2,1H3 |
| InChIKey | RHLNDYFBKMZKIZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |