C17H26N2O2 — CID 79698744
N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-3-phenoxypropanamide (PubChem CID 79698744) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-3-phenoxypropanamide.
| Compound Name | N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-3-phenoxypropanamide |
|---|---|
| PubChem CID | 79698744 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-(3-amino-2,2,4,4-tetramethylcyclobutyl)-3-phenoxypropanamide |
| SMILES | CC1(C)C(N)C(C)(C)C1NC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-16(2)14(18)17(3,4)15(16)19-13(20)10-11-21-12-8-6-5-7-9-12/h5-9,14-15H,10-11,18H2,1-4H3,(H,19,20) |
| InChIKey | LLPBZACGABEDRY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |