C14H22N4O2S — CID 79702062
2-[[2-[methyl(piperidin-4-ylmethyl)amino]acetyl]amino]thiophene-3-carboxamide (PubChem CID 79702062) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[[2-[methyl(piperidin-4-ylmethyl)amino]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[methyl(piperidin-4-ylmethyl)amino]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79702062 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[[2-[methyl(piperidin-4-ylmethyl)amino]acetyl]amino]thiophene-3-carboxamide |
| SMILES | CN(CC(=O)Nc1sccc1C(N)=O)CC1CCNCC1 |
| InChI | InChI=1S/C14H22N4O2S/c1-18(8-10-2-5-16-6-3-10)9-12(19)17-14-11(13(15)20)4-7-21-14/h4,7,10,16H,2-3,5-6,8-9H2,1H3,(H2,15,20)(H,17,19) |
| InChIKey | TUPKUXDWRAUTBY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |