C10H8F3N3O2 — CID 797201
(5S)-5-hydroxy-5-pyridin-3-yl-3-(trifluoromethyl)-4H-pyrazole-1-carbaldehyde (PubChem CID 797201) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is (5S)-5-hydroxy-5-pyridin-3-yl-3-(trifluoromethyl)-4H-pyrazole-1-carbaldehyde.
| Compound Name | (5S)-5-hydroxy-5-pyridin-3-yl-3-(trifluoromethyl)-4H-pyrazole-1-carbaldehyde |
|---|---|
| PubChem CID | 797201 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (5S)-5-hydroxy-5-pyridin-3-yl-3-(trifluoromethyl)-4H-pyrazole-1-carbaldehyde |
| SMILES | O=CN1N=C(C(F)(F)F)C[C@]1(O)c1cccnc1 |
| InChI | InChI=1S/C10H8F3N3O2/c11-10(12,13)8-4-9(18,16(6-17)15-8)7-2-1-3-14-5-7/h1-3,5-6,18H,4H2/t9-/m0/s1 |
| InChIKey | DCBKKOTYHOOXJL-VIFPVBQESA-N |
| XLogP | 1.01 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|