C15H23N3O2S — CID 79723067
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-2-methylpiperidine-1-sulfonamide (PubChem CID 79723067) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-2-methylpiperidine-1-sulfonamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 79723067 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-2-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCCCN1S(=O)(=O)NC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H23N3O2S/c1-11-4-2-3-9-18(11)21(19,20)17-15-8-5-12-10-13(16)6-7-14(12)15/h6-7,10-11,15,17H,2-5,8-9,16H2,1H3 |
| InChIKey | ZGIJXKDAAGQAIW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|