C15H21NO — CID 79726190
7-methoxy-N,2-dimethyl-1,2,3,3a,4,5-hexahydroacenaphthylen-1-amine (PubChem CID 79726190) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 7-methoxy-N,2-dimethyl-1,2,3,3a,4,5-hexahydroacenaphthylen-1-amine.
| Compound Name | 7-methoxy-N,2-dimethyl-1,2,3,3a,4,5-hexahydroacenaphthylen-1-amine |
|---|---|
| PubChem CID | 79726190 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 7-methoxy-N,2-dimethyl-1,2,3,3a,4,5-hexahydroacenaphthylen-1-amine |
| SMILES | CNC1c2cc(OC)cc3c2C(CCC3)C1C |
| InChI | InChI=1S/C15H21NO/c1-9-12-6-4-5-10-7-11(17-3)8-13(14(10)12)15(9)16-2/h7-9,12,15-16H,4-6H2,1-3H3 |
| InChIKey | WELWVKSUYYHDBZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |