C13H15ClO — CID 63821201
1-chloro-7-methoxy-1,2,3,3a,4,5-hexahydroacenaphthylene (PubChem CID 63821201) has the molecular formula C13H15ClO and a molecular weight of 222.71 g/mol. Its IUPAC name is 1-chloro-7-methoxy-1,2,3,3a,4,5-hexahydroacenaphthylene.
| Compound Name | 1-chloro-7-methoxy-1,2,3,3a,4,5-hexahydroacenaphthylene |
|---|---|
| PubChem CID | 63821201 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-chloro-7-methoxy-1,2,3,3a,4,5-hexahydroacenaphthylene |
| SMILES | COc1cc2c3c(c1)C(Cl)CC3CCC2 |
| InChI | InChI=1S/C13H15ClO/c1-15-10-5-8-3-2-4-9-6-12(14)11(7-10)13(8)9/h5,7,9,12H,2-4,6H2,1H3 |
| InChIKey | YEWOOJRPYBAAGC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.71 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|