About 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine
2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine (PubChem CID 79728574) has the molecular formula C9H13ClFN3
and a molecular weight of 217.68 g/mol. Its IUPAC name is 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine |
| PubChem CID | 79728574 |
| Molecular Formula | C9H13ClFN3 |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine |
| SMILES | CCC(CN)Nc1ncc(Cl)cc1F |
| InChI | InChI=1S/C9H13ClFN3/c1-2-7(4-12)14-9-8(11)3-6(10)5-13-9/h3,5,7H,2,4,12H2,1H3,(H,13,14) |
| InChIKey | DQLLOMAAOVZITH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine?
The IUPAC name of 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine (CID 79728574) is 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine.
What is the SMILES notation for 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine?
The canonical SMILES for 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine is CCC(CN)Nc1ncc(Cl)cc1F.
What is the InChIKey of 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine?
The InChIKey is DQLLOMAAOVZITH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClFN3/c1-2-7(4-12)14-9-8(11)3-6(10)5-13-9/h3,5,7H,2,4,12H2,1H3,(H,13,14).
What are the key properties of 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine?
2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine has a molecular weight of 217.68 g/mol, XLogP of 2.02, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(5-chloro-3-fluoro-2-pyridinyl)butane-1,2-diamine is sourced from PubChem (CID 79728574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).