C18H26N2O6S — CID 7973357
[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate (PubChem CID 7973357) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 7973357 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N2CCCC[C@@H]2C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C18H26N2O6S/c1-13-7-5-6-10-20(13)17(21)12-26-18(22)14-8-9-15(25-4)16(11-14)27(23,24)19(2)3/h8-9,11,13H,5-7,10,12H2,1-4H3/t13-/m0/s1 |
| InChIKey | CBRCXOVLGAHSFG-ZDUSSCGKSA-N |
| XLogP | 1.50 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |