C18H13BrFO5- — CID 7973436
2-[4-[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]-2-methoxyphenoxy]acetate (PubChem CID 7973436) has the molecular formula C18H13BrFO5- and a molecular weight of 408.20 g/mol. Its IUPAC name is 2-[4-[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]-2-methoxyphenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 7973436 |
| Molecular Formula | C18H13BrFO5- |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | 2-[4-[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]-2-methoxyphenoxy]acetate |
| SMILES | COc1cc(C(=O)/C=C/c2cc(Br)ccc2F)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C18H14BrFO5/c1-24-17-9-12(3-7-16(17)25-10-18(22)23)15(21)6-2-11-8-13(19)4-5-14(11)20/h2-9H,10H2,1H3,(H,22,23)/p-1/b6-2+ |
| InChIKey | PWDACYPIGNIOAW-QHHAFSJGSA-M |
| XLogP | 2.62 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|