C21H19N2O5S- — CID 9033299
2-[4-[(E)-3-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]prop-2-enoyl]-2-methoxyphenoxy]acetate (PubChem CID 9033299) has the molecular formula C21H19N2O5S- and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[4-[(E)-3-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]prop-2-enoyl]-2-methoxyphenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]prop-2-enoyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 9033299 |
| Molecular Formula | C21H19N2O5S- |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-[4-[(E)-3-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]prop-2-enoyl]-2-methoxyphenoxy]acetate |
| SMILES | COc1cc(C(=O)/C=C/c2cc(C)n(-c3nccs3)c2C)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C21H20N2O5S/c1-13-10-15(14(2)23(13)21-22-8-9-29-21)4-6-17(24)16-5-7-18(19(11-16)27-3)28-12-20(25)26/h4-11H,12H2,1-3H3,(H,25,26)/p-1/b6-4+ |
| InChIKey | BGCFBDUYWXZEMQ-GQCTYLIASA-M |
| XLogP | 2.58 |
| TPSA | 93.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|