C22H19O6- — CID 8882805
2-[4-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]-2-methoxyphenoxy]acetate (PubChem CID 8882805) has the molecular formula C22H19O6- and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]-2-methoxyphenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 8882805 |
| Molecular Formula | C22H19O6- |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[4-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]-2-methoxyphenoxy]acetate |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)c1ccc(OCC(=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C22H20O6/c1-3-18-16(15-6-4-5-7-19(15)28-18)9-10-17(23)14-8-11-20(21(12-14)26-2)27-13-22(24)25/h4-12H,3,13H2,1-2H3,(H,24,25)/p-1/b10-9+ |
| InChIKey | UTOPUGIIPVCGBM-MDZDMXLPSA-M |
| XLogP | 3.03 |
| TPSA | 88.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|