About N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine
N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine (PubChem CID 79739248) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine |
| PubChem CID | 79739248 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccccc1C1CCc2cccnc21 |
| InChI | InChI=1S/C17H20N2/c1-2-18-12-14-6-3-4-8-15(14)16-10-9-13-7-5-11-19-17(13)16/h3-8,11,16,18H,2,9-10,12H2,1H3 |
| InChIKey | QKHKFAZMILORCL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine?
The IUPAC name of N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine (CID 79739248) is N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine.
What is the SMILES notation for N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine?
The canonical SMILES for N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine is CCNCc1ccccc1C1CCc2cccnc21.
What is the InChIKey of N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine?
The InChIKey is QKHKFAZMILORCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2/c1-2-18-12-14-6-3-4-8-15(14)16-10-9-13-7-5-11-19-17(13)16/h3-8,11,16,18H,2,9-10,12H2,1H3.
What are the key properties of N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine?
N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine has a molecular weight of 252.36 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)phenyl]methyl]ethanamine is sourced from PubChem (CID 79739248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).