C12H15BrFN — CID 79739424
4-(5-bromo-2-fluorophenyl)-N-ethylbut-3-en-1-amine (PubChem CID 79739424) has the molecular formula C12H15BrFN and a molecular weight of 272.16 g/mol. Its IUPAC name is 4-(5-bromo-2-fluorophenyl)-N-ethylbut-3-en-1-amine.
| Compound Name | 4-(5-bromo-2-fluorophenyl)-N-ethylbut-3-en-1-amine |
|---|---|
| PubChem CID | 79739424 |
| Molecular Formula | C12H15BrFN |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-(5-bromo-2-fluorophenyl)-N-ethylbut-3-en-1-amine |
| SMILES | CCNCCC=Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H15BrFN/c1-2-15-8-4-3-5-10-9-11(13)6-7-12(10)14/h3,5-7,9,15H,2,4,8H2,1H3 |
| InChIKey | PZVIJKBAVOIHJS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|