C14H15BrFN3 — CID 79742894
3-(5-bromo-2-fluorophenyl)-N-ethyl-5,6-dimethylpyrazin-2-amine (PubChem CID 79742894) has the molecular formula C14H15BrFN3 and a molecular weight of 324.20 g/mol. Its IUPAC name is 3-(5-bromo-2-fluorophenyl)-N-ethyl-5,6-dimethylpyrazin-2-amine.
| Compound Name | 3-(5-bromo-2-fluorophenyl)-N-ethyl-5,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 79742894 |
| Molecular Formula | C14H15BrFN3 |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-(5-bromo-2-fluorophenyl)-N-ethyl-5,6-dimethylpyrazin-2-amine |
| SMILES | CCNc1nc(C)c(C)nc1-c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H15BrFN3/c1-4-17-14-13(18-8(2)9(3)19-14)11-7-10(15)5-6-12(11)16/h5-7H,4H2,1-3H3,(H,17,19) |
| InChIKey | VPXMRNCBWAHPOY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |