C17H19N3O2S — CID 7975270
3-(cyclopentylideneamino)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-1,3-thiazol-2-imine (PubChem CID 7975270) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 3-(cyclopentylideneamino)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 3-(cyclopentylideneamino)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7975270 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-(cyclopentylideneamino)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc3c(c2)OCCO3)n1N=C1CCCC1 |
| InChI | InChI=1S/C17H19N3O2S/c1-18-17-20(19-13-4-2-3-5-13)14(11-23-17)12-6-7-15-16(10-12)22-9-8-21-15/h6-7,10-11H,2-5,8-9H2,1H3/b18-17- |
| InChIKey | UKADWPCBRNEKFZ-ZCXUNETKSA-N |
| XLogP | 3.30 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|