C19H25N3S — CID 23885359
3-(cyclooctylideneamino)-N-ethyl-4-phenyl-1,3-thiazol-2-imine (PubChem CID 23885359) has the molecular formula C19H25N3S and a molecular weight of 327.50 g/mol. Its IUPAC name is 3-(cyclooctylideneamino)-N-ethyl-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-(cyclooctylideneamino)-N-ethyl-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23885359 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3-(cyclooctylideneamino)-N-ethyl-4-phenyl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccccc2)n1N=C1CCCCCCC1 |
| InChI | InChI=1S/C19H25N3S/c1-2-20-19-22(21-17-13-9-4-3-5-10-14-17)18(15-23-19)16-11-7-6-8-12-16/h6-8,11-12,15H,2-5,9-10,13-14H2,1H3/b20-19- |
| InChIKey | IBRJYCDXWMZZFC-VXPUYCOJSA-N |
| XLogP | 5.09 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|