C15H27N3O3 — CID 79755948
N-[4-ethyl-1-(N'-hydroxycarbamimidoyl)cyclohexyl]-2-methyloxolane-3-carboxamide (PubChem CID 79755948) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[4-ethyl-1-(N'-hydroxycarbamimidoyl)cyclohexyl]-2-methyloxolane-3-carboxamide.
| Compound Name | N-[4-ethyl-1-(N'-hydroxycarbamimidoyl)cyclohexyl]-2-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 79755948 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-[4-ethyl-1-(N'-hydroxycarbamimidoyl)cyclohexyl]-2-methyloxolane-3-carboxamide |
| SMILES | CCC1CCC(NC(=O)C2CCOC2C)(C(N)=NO)CC1 |
| InChI | InChI=1S/C15H27N3O3/c1-3-11-4-7-15(8-5-11,14(16)18-20)17-13(19)12-6-9-21-10(12)2/h10-12,20H,3-9H2,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | WPWQBDQWUJLMNR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|