C14H20BrN3O2S — CID 77007083
3-bromo-N-[4-ethyl-1-(N'-hydroxycarbamimidoyl)cyclohexyl]thiophene-2-carboxamide (PubChem CID 77007083) has the molecular formula C14H20BrN3O2S and a molecular weight of 374.30 g/mol. Its IUPAC name is 3-bromo-N-[4-ethyl-1-(N'-hydroxycarbamimidoyl)cyclohexyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[4-ethyl-1-(N'-hydroxycarbamimidoyl)cyclohexyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 77007083 |
| Molecular Formula | C14H20BrN3O2S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 3-bromo-N-[4-ethyl-1-(N'-hydroxycarbamimidoyl)cyclohexyl]thiophene-2-carboxamide |
| SMILES | CCC1CCC(NC(=O)c2sccc2Br)(C(N)=NO)CC1 |
| InChI | InChI=1S/C14H20BrN3O2S/c1-2-9-3-6-14(7-4-9,13(16)18-20)17-12(19)11-10(15)5-8-21-11/h5,8-9,20H,2-4,6-7H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | APVNLNYEHGXEGH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|