C15H16F2N2OS — CID 79758784
3-amino-2,6-difluoro-N-(1-thiophen-2-ylbutyl)benzamide (PubChem CID 79758784) has the molecular formula C15H16F2N2OS and a molecular weight of 310.37 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-(1-thiophen-2-ylbutyl)benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-(1-thiophen-2-ylbutyl)benzamide |
|---|---|
| PubChem CID | 79758784 |
| Molecular Formula | C15H16F2N2OS |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-amino-2,6-difluoro-N-(1-thiophen-2-ylbutyl)benzamide |
| SMILES | CCCC(NC(=O)c1c(F)ccc(N)c1F)c1cccs1 |
| InChI | InChI=1S/C15H16F2N2OS/c1-2-4-11(12-5-3-8-21-12)19-15(20)13-9(16)6-7-10(18)14(13)17/h3,5-8,11H,2,4,18H2,1H3,(H,19,20) |
| InChIKey | ATXJZTVPFGAUFY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|