C10H13NO2 — CID 79760181
(2-methyloxolan-3-yl)-(1H-pyrrol-3-yl)methanone (PubChem CID 79760181) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2-methyloxolan-3-yl)-(1H-pyrrol-3-yl)methanone.
| Compound Name | (2-methyloxolan-3-yl)-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 79760181 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2-methyloxolan-3-yl)-(1H-pyrrol-3-yl)methanone |
| SMILES | CC1OCCC1C(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C10H13NO2/c1-7-9(3-5-13-7)10(12)8-2-4-11-6-8/h2,4,6-7,9,11H,3,5H2,1H3 |
| InChIKey | MRWAUOHBSZHUQW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |