C12H13N5O3S — CID 79761553
5-(furan-2-yl)-3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 79761553) has the molecular formula C12H13N5O3S and a molecular weight of 307.34 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(furan-2-yl)-3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 79761553 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-(furan-2-yl)-3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccco2)NC(=O)N(Cc2cnc(NN)s2)C1=O |
| InChI | InChI=1S/C12H13N5O3S/c1-12(8-3-2-4-20-8)9(18)17(11(19)15-12)6-7-5-14-10(16-13)21-7/h2-5H,6,13H2,1H3,(H,14,16)(H,15,19) |
| InChIKey | XKLGWVAEISBZMD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|