C11H16N4O2S — CID 79775113
3-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 79775113) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 79775113 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCNc1ncc(CN2C(=O)NC(C)(C)C2=O)s1 |
| InChI | InChI=1S/C11H16N4O2S/c1-4-12-9-13-5-7(18-9)6-15-8(16)11(2,3)14-10(15)17/h5H,4,6H2,1-3H3,(H,12,13)(H,14,17) |
| InChIKey | PAMNQWKGUNSZOZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|