C13H18N4OS — CID 79763885
N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-(3-methoxyphenyl)-N-methylmethanamine (PubChem CID 79763885) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-(3-methoxyphenyl)-N-methylmethanamine.
| Compound Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-(3-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 79763885 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-1-(3-methoxyphenyl)-N-methylmethanamine |
| SMILES | COc1cccc(CN(C)Cc2cnc(NN)s2)c1 |
| InChI | InChI=1S/C13H18N4OS/c1-17(9-12-7-15-13(16-14)19-12)8-10-4-3-5-11(6-10)18-2/h3-7H,8-9,14H2,1-2H3,(H,15,16) |
| InChIKey | HBELGFKEKZLXER-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|