C11H11ClN2OS2 — CID 79763990
2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-4-methoxyaniline (PubChem CID 79763990) has the molecular formula C11H11ClN2OS2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-4-methoxyaniline.
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 79763990 |
| Molecular Formula | C11H11ClN2OS2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-4-methoxyaniline |
| SMILES | COc1ccc(N)c(SCc2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C11H11ClN2OS2/c1-15-7-2-3-9(13)10(4-7)16-6-8-5-14-11(12)17-8/h2-5H,6,13H2,1H3 |
| InChIKey | GXUQLXUOMAXBCG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|