C10H8F4INO — CID 79766480
4,4,4-trifluoro-N-(4-fluoro-2-iodophenyl)butanamide (PubChem CID 79766480) has the molecular formula C10H8F4INO and a molecular weight of 361.08 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(4-fluoro-2-iodophenyl)butanamide.
| Compound Name | 4,4,4-trifluoro-N-(4-fluoro-2-iodophenyl)butanamide |
|---|---|
| PubChem CID | 79766480 |
| Molecular Formula | C10H8F4INO |
| Molecular Weight | 361.08 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 4,4,4-trifluoro-N-(4-fluoro-2-iodophenyl)butanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C10H8F4INO/c11-6-1-2-8(7(15)5-6)16-9(17)3-4-10(12,13)14/h1-2,5H,3-4H2,(H,16,17) |
| InChIKey | SEABVDVHACKSOA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.08 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|