C10H9F4IN2O — CID 79766531
N-(4-fluoro-2-iodophenyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 79766531) has the molecular formula C10H9F4IN2O and a molecular weight of 376.09 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(4-fluoro-2-iodophenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 79766531 |
| Molecular Formula | C10H9F4IN2O |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | O=C(CNCC(F)(F)F)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C10H9F4IN2O/c11-6-1-2-8(7(15)3-6)17-9(18)4-16-5-10(12,13)14/h1-3,16H,4-5H2,(H,17,18) |
| InChIKey | HJVRRKVKCYCMDL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|