C9H8N6 — CID 79770667
5-[(1-methylpyrazol-3-yl)amino]pyrazine-2-carbonitrile (PubChem CID 79770667) has the molecular formula C9H8N6 and a molecular weight of 200.20 g/mol. Its IUPAC name is 5-[(1-methylpyrazol-3-yl)amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[(1-methylpyrazol-3-yl)amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 79770667 |
| Molecular Formula | C9H8N6 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-[(1-methylpyrazol-3-yl)amino]pyrazine-2-carbonitrile |
| SMILES | Cn1ccc(Nc2cnc(C#N)cn2)n1 |
| InChI | InChI=1S/C9H8N6/c1-15-3-2-8(14-15)13-9-6-11-7(4-10)5-12-9/h2-3,5-6H,1H3,(H,12,13,14) |
| InChIKey | VGKYJJWEMDAVRW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |