C10H11ClN4 — CID 79770740
2-chloro-1-N-(1-methylpyrazol-3-yl)benzene-1,4-diamine (PubChem CID 79770740) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-chloro-1-N-(1-methylpyrazol-3-yl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-(1-methylpyrazol-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 79770740 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-chloro-1-N-(1-methylpyrazol-3-yl)benzene-1,4-diamine |
| SMILES | Cn1ccc(Nc2ccc(N)cc2Cl)n1 |
| InChI | InChI=1S/C10H11ClN4/c1-15-5-4-10(14-15)13-9-3-2-7(12)6-8(9)11/h2-6H,12H2,1H3,(H,13,14) |
| InChIKey | KGAGWLREHQWXIH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|