About 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol
2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol (PubChem CID 79771274) has the molecular formula C11H19N3OS
and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol |
| PubChem CID | 79771274 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol |
| SMILES | Nc1ncc(CN(CCO)C2CCCC2)s1 |
| InChI | InChI=1S/C11H19N3OS/c12-11-13-7-10(16-11)8-14(5-6-15)9-3-1-2-4-9/h7,9,15H,1-6,8H2,(H2,12,13) |
| InChIKey | GRZNHLOTPLBWOI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol?
The IUPAC name of 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol (CID 79771274) is 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol.
What is the SMILES notation for 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol?
The canonical SMILES for 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol is Nc1ncc(CN(CCO)C2CCCC2)s1.
What is the InChIKey of 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol?
The InChIKey is GRZNHLOTPLBWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3OS/c12-11-13-7-10(16-11)8-14(5-6-15)9-3-1-2-4-9/h7,9,15H,1-6,8H2,(H2,12,13).
What are the key properties of 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol?
2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol has a molecular weight of 241.36 g/mol, XLogP of 1.46, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-1,3-thiazol-5-yl)methyl-cyclopentylamino]ethanol is sourced from PubChem (CID 79771274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).