C11H9F2N3O4 — CID 79772708
4-(2,6-difluoro-3-nitrobenzoyl)piperazin-2-one (PubChem CID 79772708) has the molecular formula C11H9F2N3O4 and a molecular weight of 285.21 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-nitrobenzoyl)piperazin-2-one.
| Compound Name | 4-(2,6-difluoro-3-nitrobenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 79772708 |
| Molecular Formula | C11H9F2N3O4 |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-(2,6-difluoro-3-nitrobenzoyl)piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2c(F)ccc([N+](=O)[O-])c2F)CCN1 |
| InChI | InChI=1S/C11H9F2N3O4/c12-6-1-2-7(16(19)20)10(13)9(6)11(18)15-4-3-14-8(17)5-15/h1-2H,3-5H2,(H,14,17) |
| InChIKey | HZTUXOKDIIFMGZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|