C13H7F4NO — CID 79773346
(3-amino-2,6-difluorophenyl)-(2,5-difluorophenyl)methanone (PubChem CID 79773346) has the molecular formula C13H7F4NO and a molecular weight of 269.20 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-(2,5-difluorophenyl)methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 79773346 |
| Molecular Formula | C13H7F4NO |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-(2,5-difluorophenyl)methanone |
| SMILES | Nc1ccc(F)c(C(=O)c2cc(F)ccc2F)c1F |
| InChI | InChI=1S/C13H7F4NO/c14-6-1-2-8(15)7(5-6)13(19)11-9(16)3-4-10(18)12(11)17/h1-5H,18H2 |
| InChIKey | VREQPOVISNYPKP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|