C17H11ClF2N2O — CID 175550278
(3-amino-2,6-difluorophenyl)-[5-(4-chlorophenyl)-1H-pyrrol-3-yl]methanone (PubChem CID 175550278) has the molecular formula C17H11ClF2N2O and a molecular weight of 332.74 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-[5-(4-chlorophenyl)-1H-pyrrol-3-yl]methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-[5-(4-chlorophenyl)-1H-pyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 175550278 |
| Molecular Formula | C17H11ClF2N2O |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-[5-(4-chlorophenyl)-1H-pyrrol-3-yl]methanone |
| SMILES | Nc1ccc(F)c(C(=O)c2c[nH]c(-c3ccc(Cl)cc3)c2)c1F |
| InChI | InChI=1S/C17H11ClF2N2O/c18-11-3-1-9(2-4-11)14-7-10(8-22-14)17(23)15-12(19)5-6-13(21)16(15)20/h1-8,22H,21H2 |
| InChIKey | WVUJPXKBWKLQLB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|