C10H13N3O2S — CID 79774376
1-[(2-amino-1,3-thiazol-5-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 79774376) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 79774376 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(Cc2cnc(N)s2)C(=O)C1C |
| InChI | InChI=1S/C10H13N3O2S/c1-5-6(2)9(15)13(8(5)14)4-7-3-12-10(11)16-7/h3,5-6H,4H2,1-2H3,(H2,11,12) |
| InChIKey | JTKIZJCGVMDMJU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|