C15H11BrINO3 — CID 79783341
3-[(5-bromo-2-methoxyphenyl)methyl]-5-iodo-1,3-benzoxazol-2-one (PubChem CID 79783341) has the molecular formula C15H11BrINO3 and a molecular weight of 460.07 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxyphenyl)methyl]-5-iodo-1,3-benzoxazol-2-one.
| Compound Name | 3-[(5-bromo-2-methoxyphenyl)methyl]-5-iodo-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79783341 |
| Molecular Formula | C15H11BrINO3 |
| Molecular Weight | 460.07 g/mol |
| Exact Mass | 458.90 |
| IUPAC Name | 3-[(5-bromo-2-methoxyphenyl)methyl]-5-iodo-1,3-benzoxazol-2-one |
| SMILES | COc1ccc(Br)cc1Cn1c(=O)oc2ccc(I)cc21 |
| InChI | InChI=1S/C15H11BrINO3/c1-20-13-4-2-10(16)6-9(13)8-18-12-7-11(17)3-5-14(12)21-15(18)19/h2-7H,8H2,1H3 |
| InChIKey | VTTPCIJNXWGTQS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.07 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|